C16H29N3O3S — CID 42094398
1-(2-methoxyethyl)-2-(3-methylbutylsulfonyl)-5-(pyrrolidin-1-ylmethyl)imidazole (PubChem CID 42094398) has the molecular formula C16H29N3O3S and a molecular weight of 343.49 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2-(3-methylbutylsulfonyl)-5-(pyrrolidin-1-ylmethyl)imidazole.
| Compound Name | 1-(2-methoxyethyl)-2-(3-methylbutylsulfonyl)-5-(pyrrolidin-1-ylmethyl)imidazole |
|---|---|
| PubChem CID | 42094398 |
| Molecular Formula | C16H29N3O3S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1-(2-methoxyethyl)-2-(3-methylbutylsulfonyl)-5-(pyrrolidin-1-ylmethyl)imidazole |
| SMILES | COCCn1c(CN2CCCC2)cnc1S(=O)(=O)CCC(C)C |
| InChI | InChI=1S/C16H29N3O3S/c1-14(2)6-11-23(20,21)16-17-12-15(19(16)9-10-22-3)13-18-7-4-5-8-18/h12,14H,4-11,13H2,1-3H3 |
| InChIKey | TZIBATRCQWZUCW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |