C22H27NO4 — CID 42095187
[(3S)-1-[[3-(2-hydroxyethoxy)phenyl]methyl]piperidin-3-yl]-(3-methoxyphenyl)methanone (PubChem CID 42095187) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is [(3S)-1-[[3-(2-hydroxyethoxy)phenyl]methyl]piperidin-3-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [(3S)-1-[[3-(2-hydroxyethoxy)phenyl]methyl]piperidin-3-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 42095187 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | [(3S)-1-[[3-(2-hydroxyethoxy)phenyl]methyl]piperidin-3-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)[C@H]2CCCN(Cc3cccc(OCCO)c3)C2)c1 |
| InChI | InChI=1S/C22H27NO4/c1-26-20-8-3-6-18(14-20)22(25)19-7-4-10-23(16-19)15-17-5-2-9-21(13-17)27-12-11-24/h2-3,5-6,8-9,13-14,19,24H,4,7,10-12,15-16H2,1H3/t19-/m0/s1 |
| InChIKey | FEVAZKSGKLFHFG-IBGZPJMESA-N |
| XLogP | 3.16 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |