About [3-(3,5-dimethylpyridin-1-ium-1-yl)quinoxalin-2-yl]-thiophen-2-ylsulfonylazanide
[3-(3,5-dimethylpyridin-1-ium-1-yl)quinoxalin-2-yl]-thiophen-2-ylsulfonylazanide (PubChem CID 4209877) has the molecular formula C19H16N4O2S2
and a molecular weight of 396.50 g/mol. Its IUPAC name is [3-(3,5-dimethylpyridin-1-ium-1-yl)quinoxalin-2-yl]-thiophen-2-ylsulfonylazanide.
Molecular Properties
| Compound Name | [3-(3,5-dimethylpyridin-1-ium-1-yl)quinoxalin-2-yl]-thiophen-2-ylsulfonylazanide |
| PubChem CID | 4209877 |
| Molecular Formula | C19H16N4O2S2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | [3-(3,5-dimethylpyridin-1-ium-1-yl)quinoxalin-2-yl]-thiophen-2-ylsulfonylazanide |
| SMILES | Cc1cc(C)c[n+](-c2nc3ccccc3nc2[N-]S(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C19H16N4O2S2/c1-13-10-14(2)12-23(11-13)19-18(20-15-6-3-4-7-16(15)21-19)22-27(24,25)17-8-5-9-26-17/h3-12H,1-2H3 |
| InChIKey | SOYIYIHOVYBMDZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 77.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(3,5-dimethylpyridin-1-ium-1-yl)quinoxalin-2-yl]-thiophen-2-ylsulfonylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3,5-dimethylpyridin-1-ium-1-yl)quinoxalin-2-yl]-thiophen-2-ylsulfonylazanide?
The IUPAC name of [3-(3,5-dimethylpyridin-1-ium-1-yl)quinoxalin-2-yl]-thiophen-2-ylsulfonylazanide (CID 4209877) is [3-(3,5-dimethylpyridin-1-ium-1-yl)quinoxalin-2-yl]-thiophen-2-ylsulfonylazanide.
What is the SMILES notation for [3-(3,5-dimethylpyridin-1-ium-1-yl)quinoxalin-2-yl]-thiophen-2-ylsulfonylazanide?
The canonical SMILES for [3-(3,5-dimethylpyridin-1-ium-1-yl)quinoxalin-2-yl]-thiophen-2-ylsulfonylazanide is Cc1cc(C)c[n+](-c2nc3ccccc3nc2[N-]S(=O)(=O)c2cccs2)c1.
What is the InChIKey of [3-(3,5-dimethylpyridin-1-ium-1-yl)quinoxalin-2-yl]-thiophen-2-ylsulfonylazanide?
The InChIKey is SOYIYIHOVYBMDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O2S2/c1-13-10-14(2)12-23(11-13)19-18(20-15-6-3-4-7-16(15)21-19)22-27(24,25)17-8-5-9-26-17/h3-12H,1-2H3.
What are the key properties of [3-(3,5-dimethylpyridin-1-ium-1-yl)quinoxalin-2-yl]-thiophen-2-ylsulfonylazanide?
[3-(3,5-dimethylpyridin-1-ium-1-yl)quinoxalin-2-yl]-thiophen-2-ylsulfonylazanide has a molecular weight of 396.50 g/mol, XLogP of 3.98, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3,5-dimethylpyridin-1-ium-1-yl)quinoxalin-2-yl]-thiophen-2-ylsulfonylazanide is sourced from PubChem (CID 4209877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).