C17H16FN5 — CID 42100368
5-(4-fluorophenyl)-N-(3-pyridin-3-ylpropyl)-1,2,4-triazin-3-amine (PubChem CID 42100368) has the molecular formula C17H16FN5 and a molecular weight of 309.35 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(3-pyridin-3-ylpropyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(4-fluorophenyl)-N-(3-pyridin-3-ylpropyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 42100368 |
| Molecular Formula | C17H16FN5 |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(3-pyridin-3-ylpropyl)-1,2,4-triazin-3-amine |
| SMILES | Fc1ccc(-c2cnnc(NCCCc3cccnc3)n2)cc1 |
| InChI | InChI=1S/C17H16FN5/c18-15-7-5-14(6-8-15)16-12-21-23-17(22-16)20-10-2-4-13-3-1-9-19-11-13/h1,3,5-9,11-12H,2,4,10H2,(H,20,22,23) |
| InChIKey | JRNWPNBKBJFJPI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|