C20H24N2O2S — CID 42101235
1-[(3S)-3-(4-methoxyanilino)piperidin-1-yl]-2-phenylsulfanylethanone (PubChem CID 42101235) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is 1-[(3S)-3-(4-methoxyanilino)piperidin-1-yl]-2-phenylsulfanylethanone.
| Compound Name | 1-[(3S)-3-(4-methoxyanilino)piperidin-1-yl]-2-phenylsulfanylethanone |
|---|---|
| PubChem CID | 42101235 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1-[(3S)-3-(4-methoxyanilino)piperidin-1-yl]-2-phenylsulfanylethanone |
| SMILES | COc1ccc(N[C@H]2CCCN(C(=O)CSc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C20H24N2O2S/c1-24-18-11-9-16(10-12-18)21-17-6-5-13-22(14-17)20(23)15-25-19-7-3-2-4-8-19/h2-4,7-12,17,21H,5-6,13-15H2,1H3/t17-/m0/s1 |
| InChIKey | SJQGKOZUMJVDKR-KRWDZBQOSA-N |
| XLogP | 3.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|