C14H11Cl2N3OS2 — CID 42107373
(5R)-3-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-imino-5-methyl-1,3-thiazolidin-4-one (PubChem CID 42107373) has the molecular formula C14H11Cl2N3OS2 and a molecular weight of 372.30 g/mol. Its IUPAC name is (5R)-3-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-imino-5-methyl-1,3-thiazolidin-4-one.
| Compound Name | (5R)-3-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-imino-5-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 42107373 |
| Molecular Formula | C14H11Cl2N3OS2 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | (5R)-3-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-imino-5-methyl-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\S[C@H](C)C(=O)N1c1ncc(Cc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C14H11Cl2N3OS2/c1-7-12(20)19(13(17)21-7)14-18-6-10(22-14)4-8-2-3-9(15)5-11(8)16/h2-3,5-7,17H,4H2,1H3/b17-13-/t7-/m1/s1 |
| InChIKey | CPNIXUAETWIPBI-REWHPJLXSA-N |
| XLogP | 4.44 |
| TPSA | 57.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|