C22H22FN3O3 — CID 42109408
3-[(4-fluorophenyl)methyl]-8-phenacyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 42109408) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-8-phenacyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(4-fluorophenyl)methyl]-8-phenacyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 42109408 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-8-phenacyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C(CN1CCC2(CC1)NC(=O)N(Cc1ccc(F)cc1)C2=O)c1ccccc1 |
| InChI | InChI=1S/C22H22FN3O3/c23-18-8-6-16(7-9-18)14-26-20(28)22(24-21(26)29)10-12-25(13-11-22)15-19(27)17-4-2-1-3-5-17/h1-9H,10-15H2,(H,24,29) |
| InChIKey | IEFXHHZMOWMWIL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|