C19H22FN3O4 — CID 42109455
3-[(4-fluorophenyl)methyl]-8-[(2S)-oxolane-2-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 42109455) has the molecular formula C19H22FN3O4 and a molecular weight of 375.40 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-8-[(2S)-oxolane-2-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(4-fluorophenyl)methyl]-8-[(2S)-oxolane-2-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 42109455 |
| Molecular Formula | C19H22FN3O4 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-8-[(2S)-oxolane-2-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C([C@@H]1CCCO1)N1CCC2(CC1)NC(=O)N(Cc1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C19H22FN3O4/c20-14-5-3-13(4-6-14)12-23-17(25)19(21-18(23)26)7-9-22(10-8-19)16(24)15-2-1-11-27-15/h3-6,15H,1-2,7-12H2,(H,21,26)/t15-/m0/s1 |
| InChIKey | YTBKSTCLMYSHIN-HNNXBMFYSA-N |
| XLogP | 1.42 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|