About N-([1,2]oxazolo[5,4-b]pyridin-3-yl)propanamide
N-([1,2]oxazolo[5,4-b]pyridin-3-yl)propanamide (PubChem CID 42110353) has the molecular formula C9H9N3O2
and a molecular weight of 191.19 g/mol. Its IUPAC name is N-([1,2]oxazolo[5,4-b]pyridin-3-yl)propanamide.
Molecular Properties
| Compound Name | N-([1,2]oxazolo[5,4-b]pyridin-3-yl)propanamide |
| PubChem CID | 42110353 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | N-([1,2]oxazolo[5,4-b]pyridin-3-yl)propanamide |
| SMILES | CCC(=O)Nc1noc2ncccc12 |
| InChI | InChI=1S/C9H9N3O2/c1-2-7(13)11-8-6-4-3-5-10-9(6)14-12-8/h3-5H,2H2,1H3,(H,11,12,13) |
| InChIKey | LPKYLYQRZGIMAL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-([1,2]oxazolo[5,4-b]pyridin-3-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-([1,2]oxazolo[5,4-b]pyridin-3-yl)propanamide?
The IUPAC name of N-([1,2]oxazolo[5,4-b]pyridin-3-yl)propanamide (CID 42110353) is N-([1,2]oxazolo[5,4-b]pyridin-3-yl)propanamide.
What is the SMILES notation for N-([1,2]oxazolo[5,4-b]pyridin-3-yl)propanamide?
The canonical SMILES for N-([1,2]oxazolo[5,4-b]pyridin-3-yl)propanamide is CCC(=O)Nc1noc2ncccc12.
What is the InChIKey of N-([1,2]oxazolo[5,4-b]pyridin-3-yl)propanamide?
The InChIKey is LPKYLYQRZGIMAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2/c1-2-7(13)11-8-6-4-3-5-10-9(6)14-12-8/h3-5H,2H2,1H3,(H,11,12,13).
What are the key properties of N-([1,2]oxazolo[5,4-b]pyridin-3-yl)propanamide?
N-([1,2]oxazolo[5,4-b]pyridin-3-yl)propanamide has a molecular weight of 191.19 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-([1,2]oxazolo[5,4-b]pyridin-3-yl)propanamide is sourced from PubChem (CID 42110353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).