C45H42N4O7 — CID 4211084
6'-[2-(2-hydroxyethoxy)phenyl]-N-(4-morpholin-4-ylphenyl)-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxamide (PubChem CID 4211084) has the molecular formula C45H42N4O7 and a molecular weight of 750.85 g/mol. Its IUPAC name is 6'-[2-(2-hydroxyethoxy)phenyl]-N-(4-morpholin-4-ylphenyl)-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxamide.
| Compound Name | 6'-[2-(2-hydroxyethoxy)phenyl]-N-(4-morpholin-4-ylphenyl)-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxamide |
|---|---|
| PubChem CID | 4211084 |
| Molecular Formula | C45H42N4O7 |
| Molecular Weight | 750.85 g/mol |
| Exact Mass | 750.31 |
| IUPAC Name | 6'-[2-(2-hydroxyethoxy)phenyl]-N-(4-morpholin-4-ylphenyl)-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxamide |
| SMILES | O=C1OC(c2ccccc2)C(c2ccccc2)N2C1C(C(=O)Nc1ccc(N3CCOCC3)cc1)C1(C(=O)Nc3ccccc31)C2c1ccccc1OCCO |
| InChI | InChI=1S/C45H42N4O7/c50-25-28-55-36-18-10-7-15-33(36)41-45(34-16-8-9-17-35(34)47-44(45)53)37(42(51)46-31-19-21-32(22-20-31)48-23-26-54-27-24-48)39-43(52)56-40(30-13-5-2-6-14-30)38(49(39)41)29-11-3-1-4-12-29/h1-22,37-41,50H,23-28H2,(H,46,51)(H,47,53) |
| InChIKey | ATJGMOLBIUZTRX-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 129.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.85 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|