C19H23N3O5S — CID 42112029
N-(5-acetamido-2-methoxyphenyl)-5-(ethylsulfamoyl)-2-methylbenzamide (PubChem CID 42112029) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is N-(5-acetamido-2-methoxyphenyl)-5-(ethylsulfamoyl)-2-methylbenzamide.
| Compound Name | N-(5-acetamido-2-methoxyphenyl)-5-(ethylsulfamoyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 42112029 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-(5-acetamido-2-methoxyphenyl)-5-(ethylsulfamoyl)-2-methylbenzamide |
| SMILES | CCNS(=O)(=O)c1ccc(C)c(C(=O)Nc2cc(NC(C)=O)ccc2OC)c1 |
| InChI | InChI=1S/C19H23N3O5S/c1-5-20-28(25,26)15-8-6-12(2)16(11-15)19(24)22-17-10-14(21-13(3)23)7-9-18(17)27-4/h6-11,20H,5H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | AABPCLFXJRKBFN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |