C21H29N5O3S2 — CID 42122384
2-[[5-[3-(diethylsulfamoyl)phenyl]-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-ynylacetamide (PubChem CID 42122384) has the molecular formula C21H29N5O3S2 and a molecular weight of 463.63 g/mol. Its IUPAC name is 2-[[5-[3-(diethylsulfamoyl)phenyl]-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-ynylacetamide.
| Compound Name | 2-[[5-[3-(diethylsulfamoyl)phenyl]-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 42122384 |
| Molecular Formula | C21H29N5O3S2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 2-[[5-[3-(diethylsulfamoyl)phenyl]-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CSc1nnc(-c2cccc(S(=O)(=O)N(CC)CC)c2)n1CC(C)C |
| InChI | InChI=1S/C21H29N5O3S2/c1-6-12-22-19(27)15-30-21-24-23-20(26(21)14-16(4)5)17-10-9-11-18(13-17)31(28,29)25(7-2)8-3/h1,9-11,13,16H,7-8,12,14-15H2,2-5H3,(H,22,27) |
| InChIKey | CIYFEDRNQVROBO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|