C10H8F8N2S — CID 4213155
3,5,6-trifluoro-4-(1,1,2,2,2-pentafluoroethylsulfanyl)-N-propylpyridin-2-amine (PubChem CID 4213155) has the molecular formula C10H8F8N2S and a molecular weight of 340.24 g/mol. Its IUPAC name is 3,5,6-trifluoro-4-(1,1,2,2,2-pentafluoroethylsulfanyl)-N-propylpyridin-2-amine.
| Compound Name | 3,5,6-trifluoro-4-(1,1,2,2,2-pentafluoroethylsulfanyl)-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 4213155 |
| Molecular Formula | C10H8F8N2S |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 3,5,6-trifluoro-4-(1,1,2,2,2-pentafluoroethylsulfanyl)-N-propylpyridin-2-amine |
| SMILES | CCCNc1nc(F)c(F)c(SC(F)(F)C(F)(F)F)c1F |
| InChI | InChI=1S/C10H8F8N2S/c1-2-3-19-8-5(12)6(4(11)7(13)20-8)21-10(17,18)9(14,15)16/h2-3H2,1H3,(H,19,20) |
| InChIKey | MHASMFSWZBTAOS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|