C16H15ClN4 — CID 4213259
N-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]-1-pyridin-2-ylmethanamine (PubChem CID 4213259) has the molecular formula C16H15ClN4 and a molecular weight of 298.78 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]-1-pyridin-2-ylmethanamine.
| Compound Name | N-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]-1-pyridin-2-ylmethanamine |
|---|---|
| PubChem CID | 4213259 |
| Molecular Formula | C16H15ClN4 |
| Molecular Weight | 298.78 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]-1-pyridin-2-ylmethanamine |
| SMILES | Clc1ccc(-c2[nH]ncc2CNCc2ccccn2)cc1 |
| InChI | InChI=1S/C16H15ClN4/c17-14-6-4-12(5-7-14)16-13(10-20-21-16)9-18-11-15-3-1-2-8-19-15/h1-8,10,18H,9,11H2,(H,20,21) |
| InChIKey | TYFQONZKWAIVMH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |