About (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-phenyladamantane-1-carboxylate
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-phenyladamantane-1-carboxylate (PubChem CID 4213722) has the molecular formula C26H27NO6
and a molecular weight of 449.50 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-phenyladamantane-1-carboxylate.
Molecular Properties
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-phenyladamantane-1-carboxylate |
| PubChem CID | 4213722 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-phenyladamantane-1-carboxylate |
| SMILES | O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)C12CC3CC(C1)CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C26H27NO6/c28-24(32-14-20-8-22(27(29)30)7-19-13-31-16-33-23(19)20)26-11-17-6-18(12-26)10-25(9-17,15-26)21-4-2-1-3-5-21/h1-5,7-8,17-18H,6,9-16H2 |
| InChIKey | GLXLJGCLTAXMIV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-phenyladamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-phenyladamantane-1-carboxylate?
The IUPAC name of (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-phenyladamantane-1-carboxylate (CID 4213722) is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-phenyladamantane-1-carboxylate.
What is the SMILES notation for (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-phenyladamantane-1-carboxylate?
The canonical SMILES for (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-phenyladamantane-1-carboxylate is O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)C12CC3CC(C1)CC(c1ccccc1)(C3)C2.
What is the InChIKey of (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-phenyladamantane-1-carboxylate?
The InChIKey is GLXLJGCLTAXMIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27NO6/c28-24(32-14-20-8-22(27(29)30)7-19-13-31-16-33-23(19)20)26-11-17-6-18(12-26)10-25(9-17,15-26)21-4-2-1-3-5-21/h1-5,7-8,17-18H,6,9-16H2.
What are the key properties of (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-phenyladamantane-1-carboxylate?
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-phenyladamantane-1-carboxylate has a molecular weight of 449.50 g/mol, XLogP of 5.04, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-phenyladamantane-1-carboxylate is sourced from PubChem (CID 4213722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).