About 1-aminoethylideneazanium
1-aminoethylideneazanium (PubChem CID 4214230) has the molecular formula C2H7N2+
and a molecular weight of 59.09 g/mol. Its IUPAC name is 1-aminoethylideneazanium.
Molecular Properties
| Compound Name | 1-aminoethylideneazanium |
| PubChem CID | 4214230 |
| Molecular Formula | C2H7N2+ |
| Molecular Weight | 59.09 g/mol |
| Exact Mass | 59.06 |
| IUPAC Name | 1-aminoethylideneazanium |
| SMILES | CC(N)=[NH2+] |
| InChI | InChI=1S/C2H6N2/c1-2(3)4/h1H3,(H3,3,4)/p+1 |
| InChIKey | OQLZINXFSUDMHM-UHFFFAOYSA-O |
| XLogP | -1.88 |
| TPSA | 51.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 59.09 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethylideneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethylideneazanium?
The IUPAC name of 1-aminoethylideneazanium (CID 4214230) is 1-aminoethylideneazanium.
What is the SMILES notation for 1-aminoethylideneazanium?
The canonical SMILES for 1-aminoethylideneazanium is CC(N)=[NH2+].
What is the InChIKey of 1-aminoethylideneazanium?
The InChIKey is OQLZINXFSUDMHM-UHFFFAOYSA-O. The full InChI is InChI=1S/C2H6N2/c1-2(3)4/h1H3,(H3,3,4)/p+1.
What are the key properties of 1-aminoethylideneazanium?
1-aminoethylideneazanium has a molecular weight of 59.09 g/mol, XLogP of -1.88, 0 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethylideneazanium is sourced from PubChem (CID 4214230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).