C18H17IN4O3S — CID 42143740
4-iodo-N-[3-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)propyl]benzenesulfonamide (PubChem CID 42143740) has the molecular formula C18H17IN4O3S and a molecular weight of 496.33 g/mol. Its IUPAC name is 4-iodo-N-[3-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)propyl]benzenesulfonamide.
| Compound Name | 4-iodo-N-[3-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42143740 |
| Molecular Formula | C18H17IN4O3S |
| Molecular Weight | 496.33 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | 4-iodo-N-[3-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)propyl]benzenesulfonamide |
| SMILES | O=c1ccc(-c2cccnc2)nn1CCCNS(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C18H17IN4O3S/c19-15-4-6-16(7-5-15)27(25,26)21-11-2-12-23-18(24)9-8-17(22-23)14-3-1-10-20-13-14/h1,3-10,13,21H,2,11-12H2 |
| InChIKey | DWCMRHCLKTUHJA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|