C29H29N3O3 — CID 4215797
2-[4-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-4-oxobutyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 4215797) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-[4-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-4-oxobutyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[4-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-4-oxobutyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 4215797 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 2-[4-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-4-oxobutyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | Cc1ccc2c(c1)C1CN(C)CCC1N2C(=O)CCCN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C29H29N3O3/c1-18-11-12-24-22(16-18)23-17-30(2)15-13-25(23)32(24)26(33)10-5-14-31-28(34)20-8-3-6-19-7-4-9-21(27(19)20)29(31)35/h3-4,6-9,11-12,16,23,25H,5,10,13-15,17H2,1-2H3 |
| InChIKey | GUUPDMWWFXFUDR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|