C10H13NO2 — CID 42158
2-Methyl-1,2,3,4-tetrahydroisoquinoline-4,6-diol (PubChem CID 42158) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 2-methyl-3,4-dihydro-1H-isoquinoline-4,6-diol.
| Compound Name | 2-Methyl-1,2,3,4-tetrahydroisoquinoline-4,6-diol |
|---|---|
| PubChem CID | 42158 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2-methyl-3,4-dihydro-1H-isoquinoline-4,6-diol |
| SMILES | CN1CC(C2=C(C1)C=CC(=C2)O)O |
| InChIKey | GXNCQQCQUUCKLX-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 0 |
| Heavy Atoms | 13 |
| Complexity | 186 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |