C15H17IN2O2S — CID 4216
1-(5-iodonaphthalen-1-yl)sulfonyl-1,4-diazepane (PubChem CID 4216) has the molecular formula C15H17IN2O2S and a molecular weight of 416.28 g/mol. Its IUPAC name is 1-(5-iodonaphthalen-1-yl)sulfonyl-1,4-diazepane.
| Compound Name | 1-(5-iodonaphthalen-1-yl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 4216 |
| Molecular Formula | C15H17IN2O2S |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | 1-(5-iodonaphthalen-1-yl)sulfonyl-1,4-diazepane |
| SMILES | O=S(=O)(c1cccc2c(I)cccc12)N1CCCNCC1 |
| InChI | InChI=1S/C15H17IN2O2S/c16-14-6-1-5-13-12(14)4-2-7-15(13)21(19,20)18-10-3-8-17-9-11-18/h1-2,4-7,17H,3,8-11H2 |
| InChIKey | GEHJIACZUFWBTK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|