C21H30N2O4 — CID 42160228
3-[1-[2-(4-methoxyphenoxy)acetyl]piperidin-4-yl]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 42160228) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 3-[1-[2-(4-methoxyphenoxy)acetyl]piperidin-4-yl]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 3-[1-[2-(4-methoxyphenoxy)acetyl]piperidin-4-yl]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 42160228 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 3-[1-[2-(4-methoxyphenoxy)acetyl]piperidin-4-yl]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | COc1ccc(OCC(=O)N2CCC(CCC(=O)N3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C21H30N2O4/c1-26-18-5-7-19(8-6-18)27-16-21(25)23-14-10-17(11-15-23)4-9-20(24)22-12-2-3-13-22/h5-8,17H,2-4,9-16H2,1H3 |
| InChIKey | SFYGFKAZXWJADA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |