C19H16F8NO3P — CID 4216713
methyl N-(1-diphenylphosphoryl-2,2,3,3,4,4,5,5-octafluoropentyl)carbamate (PubChem CID 4216713) has the molecular formula C19H16F8NO3P and a molecular weight of 489.30 g/mol. Its IUPAC name is methyl N-(1-diphenylphosphoryl-2,2,3,3,4,4,5,5-octafluoropentyl)carbamate.
| Compound Name | methyl N-(1-diphenylphosphoryl-2,2,3,3,4,4,5,5-octafluoropentyl)carbamate |
|---|---|
| PubChem CID | 4216713 |
| Molecular Formula | C19H16F8NO3P |
| Molecular Weight | 489.30 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | methyl N-(1-diphenylphosphoryl-2,2,3,3,4,4,5,5-octafluoropentyl)carbamate |
| SMILES | COC(=O)NC(C(F)(F)C(F)(F)C(F)(F)C(F)F)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16F8NO3P/c1-31-16(29)28-15(18(24,25)19(26,27)17(22,23)14(20)21)32(30,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11,14-15H,1H3,(H,28,29) |
| InChIKey | HTSNWPSSFCJLSG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.30 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|