C16H15F3N4OS — CID 42167147
2-[3-[4-methyl-2-[(2,3,6-trifluorophenyl)methylamino]-1,3-thiazol-5-yl]pyrazol-1-yl]ethanol (PubChem CID 42167147) has the molecular formula C16H15F3N4OS and a molecular weight of 368.38 g/mol. Its IUPAC name is 2-[3-[4-methyl-2-[(2,3,6-trifluorophenyl)methylamino]-1,3-thiazol-5-yl]pyrazol-1-yl]ethanol.
| Compound Name | 2-[3-[4-methyl-2-[(2,3,6-trifluorophenyl)methylamino]-1,3-thiazol-5-yl]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 42167147 |
| Molecular Formula | C16H15F3N4OS |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2-[3-[4-methyl-2-[(2,3,6-trifluorophenyl)methylamino]-1,3-thiazol-5-yl]pyrazol-1-yl]ethanol |
| SMILES | Cc1nc(NCc2c(F)ccc(F)c2F)sc1-c1ccn(CCO)n1 |
| InChI | InChI=1S/C16H15F3N4OS/c1-9-15(13-4-5-23(22-13)6-7-24)25-16(21-9)20-8-10-11(17)2-3-12(18)14(10)19/h2-5,24H,6-8H2,1H3,(H,20,21) |
| InChIKey | YWZZYLIFJWGNDP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|