C15H20ClNO3S — CID 4216825
ethyl 2-[(2-chloroacetyl)amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 4216825) has the molecular formula C15H20ClNO3S and a molecular weight of 329.85 g/mol. Its IUPAC name is ethyl 2-[(2-chloroacetyl)amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-chloroacetyl)amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4216825 |
| Molecular Formula | C15H20ClNO3S |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | ethyl 2-[(2-chloroacetyl)amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCl)sc2c1CCCCCC2 |
| InChI | InChI=1S/C15H20ClNO3S/c1-2-20-15(19)13-10-7-5-3-4-6-8-11(10)21-14(13)17-12(18)9-16/h2-9H2,1H3,(H,17,18) |
| InChIKey | BOIJQEPURKBHGT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|