C18H20N2O4S — CID 42168256
(5Z)-5-[2-[(2S)-2-butyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-oxoethylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 42168256) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is (5Z)-5-[2-[(2S)-2-butyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-oxoethylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[2-[(2S)-2-butyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-oxoethylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 42168256 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (5Z)-5-[2-[(2S)-2-butyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-oxoethylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCC[C@H]1CN(C(=O)/C=C2\SC(=O)NC2=O)Cc2ccccc2O1 |
| InChI | InChI=1S/C18H20N2O4S/c1-2-3-7-13-11-20(10-12-6-4-5-8-14(12)24-13)16(21)9-15-17(22)19-18(23)25-15/h4-6,8-9,13H,2-3,7,10-11H2,1H3,(H,19,22,23)/b15-9-/t13-/m0/s1 |
| InChIKey | PNZDMJJSYTWOKO-GRRFOWRYSA-N |
| XLogP | 2.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|