C20H14F3N3O2 — CID 42168406
2,4,5-trifluoro-N-[[(2S)-7-pyrimidin-2-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]benzamide (PubChem CID 42168406) has the molecular formula C20H14F3N3O2 and a molecular weight of 385.35 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-[[(2S)-7-pyrimidin-2-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]benzamide.
| Compound Name | 2,4,5-trifluoro-N-[[(2S)-7-pyrimidin-2-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 42168406 |
| Molecular Formula | C20H14F3N3O2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2,4,5-trifluoro-N-[[(2S)-7-pyrimidin-2-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]benzamide |
| SMILES | O=C(NC[C@@H]1Cc2cccc(-c3ncccn3)c2O1)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C20H14F3N3O2/c21-15-9-17(23)16(22)8-14(15)20(27)26-10-12-7-11-3-1-4-13(18(11)28-12)19-24-5-2-6-25-19/h1-6,8-9,12H,7,10H2,(H,26,27)/t12-/m0/s1 |
| InChIKey | YBUBWWOROVLPPP-LBPRGKRZSA-N |
| XLogP | 3.29 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|