C28H36N2O6 — CID 42169461
methyl 3-[(4R)-2,2-dimethyloxane-4-carbonyl]-7-oxo-9-(3-phenylpropoxy)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate (PubChem CID 42169461) has the molecular formula C28H36N2O6 and a molecular weight of 496.60 g/mol. Its IUPAC name is methyl 3-[(4R)-2,2-dimethyloxane-4-carbonyl]-7-oxo-9-(3-phenylpropoxy)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate.
| Compound Name | methyl 3-[(4R)-2,2-dimethyloxane-4-carbonyl]-7-oxo-9-(3-phenylpropoxy)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate |
|---|---|
| PubChem CID | 42169461 |
| Molecular Formula | C28H36N2O6 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | methyl 3-[(4R)-2,2-dimethyloxane-4-carbonyl]-7-oxo-9-(3-phenylpropoxy)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate |
| SMILES | COC(=O)c1c(OCCCc2ccccc2)cc(=O)n2c1CCN(C(=O)[C@@H]1CCOC(C)(C)C1)CC2 |
| InChI | InChI=1S/C28H36N2O6/c1-28(2)19-21(12-17-36-28)26(32)29-13-11-22-25(27(33)34-3)23(18-24(31)30(22)15-14-29)35-16-7-10-20-8-5-4-6-9-20/h4-6,8-9,18,21H,7,10-17,19H2,1-3H3/t21-/m1/s1 |
| InChIKey | ANDSTSXUIRZFHY-OAQYLSRUSA-N |
| XLogP | 3.24 |
| TPSA | 87.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|