C20H25ClN4O2S — CID 42170235
3-[(2R)-2-[(4-chlorophenyl)methyl]-5-oxopyrrolidin-2-yl]-N-[2-(1-methylimidazol-2-yl)sulfanylethyl]propanamide (PubChem CID 42170235) has the molecular formula C20H25ClN4O2S and a molecular weight of 420.97 g/mol. Its IUPAC name is 3-[(2R)-2-[(4-chlorophenyl)methyl]-5-oxopyrrolidin-2-yl]-N-[2-(1-methylimidazol-2-yl)sulfanylethyl]propanamide.
| Compound Name | 3-[(2R)-2-[(4-chlorophenyl)methyl]-5-oxopyrrolidin-2-yl]-N-[2-(1-methylimidazol-2-yl)sulfanylethyl]propanamide |
|---|---|
| PubChem CID | 42170235 |
| Molecular Formula | C20H25ClN4O2S |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 3-[(2R)-2-[(4-chlorophenyl)methyl]-5-oxopyrrolidin-2-yl]-N-[2-(1-methylimidazol-2-yl)sulfanylethyl]propanamide |
| SMILES | Cn1ccnc1SCCNC(=O)CC[C@@]1(Cc2ccc(Cl)cc2)CCC(=O)N1 |
| InChI | InChI=1S/C20H25ClN4O2S/c1-25-12-10-23-19(25)28-13-11-22-17(26)6-8-20(9-7-18(27)24-20)14-15-2-4-16(21)5-3-15/h2-5,10,12H,6-9,11,13-14H2,1H3,(H,22,26)(H,24,27)/t20-/m0/s1 |
| InChIKey | SYBDOUAHIMPUNN-FQEVSTJZSA-N |
| XLogP | 2.95 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|