C23H26N4O4 — CID 42170472
3-[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl]-N-methyl-N-(4,5,6,7-tetrahydro-1H-indazol-3-ylmethyl)-1,2-oxazole-5-carboxamide (PubChem CID 42170472) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 3-[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl]-N-methyl-N-(4,5,6,7-tetrahydro-1H-indazol-3-ylmethyl)-1,2-oxazole-5-carboxamide.
| Compound Name | 3-[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl]-N-methyl-N-(4,5,6,7-tetrahydro-1H-indazol-3-ylmethyl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 42170472 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 3-[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl]-N-methyl-N-(4,5,6,7-tetrahydro-1H-indazol-3-ylmethyl)-1,2-oxazole-5-carboxamide |
| SMILES | C[C@@H](Cc1ccc2c(c1)OCO2)c1cc(C(=O)N(C)Cc2n[nH]c3c2CCCC3)on1 |
| InChI | InChI=1S/C23H26N4O4/c1-14(9-15-7-8-20-21(10-15)30-13-29-20)18-11-22(31-26-18)23(28)27(2)12-19-16-5-3-4-6-17(16)24-25-19/h7-8,10-11,14H,3-6,9,12-13H2,1-2H3,(H,24,25)/t14-/m0/s1 |
| InChIKey | ATOJBAULHUNTCQ-AWEZNQCLSA-N |
| XLogP | 3.62 |
| TPSA | 93.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |