About 3-(4-phenyl-1,2,4-triazol-4-ium-1-yl)propane-1-sulfonate
3-(4-phenyl-1,2,4-triazol-4-ium-1-yl)propane-1-sulfonate (PubChem CID 4217229) has the molecular formula C11H13N3O3S
and a molecular weight of 267.31 g/mol. Its IUPAC name is 3-(4-phenyl-1,2,4-triazol-4-ium-1-yl)propane-1-sulfonate.
Molecular Properties
| Compound Name | 3-(4-phenyl-1,2,4-triazol-4-ium-1-yl)propane-1-sulfonate |
| PubChem CID | 4217229 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 3-(4-phenyl-1,2,4-triazol-4-ium-1-yl)propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCn1c[n+](-c2ccccc2)cn1 |
| InChI | InChI=1S/C11H13N3O3S/c15-18(16,17)8-4-7-14-10-13(9-12-14)11-5-2-1-3-6-11/h1-3,5-6,9-10H,4,7-8H2 |
| InChIKey | MEEZIMHSGUUOKW-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-phenyl-1,2,4-triazol-4-ium-1-yl)propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-phenyl-1,2,4-triazol-4-ium-1-yl)propane-1-sulfonate?
The IUPAC name of 3-(4-phenyl-1,2,4-triazol-4-ium-1-yl)propane-1-sulfonate (CID 4217229) is 3-(4-phenyl-1,2,4-triazol-4-ium-1-yl)propane-1-sulfonate.
What is the SMILES notation for 3-(4-phenyl-1,2,4-triazol-4-ium-1-yl)propane-1-sulfonate?
The canonical SMILES for 3-(4-phenyl-1,2,4-triazol-4-ium-1-yl)propane-1-sulfonate is O=S(=O)([O-])CCCn1c[n+](-c2ccccc2)cn1.
What is the InChIKey of 3-(4-phenyl-1,2,4-triazol-4-ium-1-yl)propane-1-sulfonate?
The InChIKey is MEEZIMHSGUUOKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O3S/c15-18(16,17)8-4-7-14-10-13(9-12-14)11-5-2-1-3-6-11/h1-3,5-6,9-10H,4,7-8H2.
What are the key properties of 3-(4-phenyl-1,2,4-triazol-4-ium-1-yl)propane-1-sulfonate?
3-(4-phenyl-1,2,4-triazol-4-ium-1-yl)propane-1-sulfonate has a molecular weight of 267.31 g/mol, XLogP of 0.10, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-phenyl-1,2,4-triazol-4-ium-1-yl)propane-1-sulfonate is sourced from PubChem (CID 4217229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).