C20H19ClN4O3S — CID 42173880
N-[6-[4-[(2-chlorophenyl)methylamino]-4-oxobutyl]sulfanylpyridazin-3-yl]furan-2-carboxamide (PubChem CID 42173880) has the molecular formula C20H19ClN4O3S and a molecular weight of 430.92 g/mol. Its IUPAC name is N-[6-[4-[(2-chlorophenyl)methylamino]-4-oxobutyl]sulfanylpyridazin-3-yl]furan-2-carboxamide.
| Compound Name | N-[6-[4-[(2-chlorophenyl)methylamino]-4-oxobutyl]sulfanylpyridazin-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42173880 |
| Molecular Formula | C20H19ClN4O3S |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | N-[6-[4-[(2-chlorophenyl)methylamino]-4-oxobutyl]sulfanylpyridazin-3-yl]furan-2-carboxamide |
| SMILES | O=C(CCCSc1ccc(NC(=O)c2ccco2)nn1)NCc1ccccc1Cl |
| InChI | InChI=1S/C20H19ClN4O3S/c21-15-6-2-1-5-14(15)13-22-18(26)8-4-12-29-19-10-9-17(24-25-19)23-20(27)16-7-3-11-28-16/h1-3,5-7,9-11H,4,8,12-13H2,(H,22,26)(H,23,24,27) |
| InChIKey | HIWICQXGFRLJFJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|