C22H27N2O5S+ — CID 4217594
1-(2,5-dimethoxyphenyl)-3-(3,4-dimethoxyphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol (PubChem CID 4217594) has the molecular formula C22H27N2O5S+ and a molecular weight of 431.53 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-(3,4-dimethoxyphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-(3,4-dimethoxyphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol |
|---|---|
| PubChem CID | 4217594 |
| Molecular Formula | C22H27N2O5S+ |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-(3,4-dimethoxyphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol |
| SMILES | COc1ccc(OC)c(N2CC(O)(c3ccc(OC)c(OC)c3)[N+]3=C2SCCC3)c1 |
| InChI | InChI=1S/C22H27N2O5S/c1-26-16-7-9-18(27-2)17(13-16)23-14-22(25,24-10-5-11-30-21(23)24)15-6-8-19(28-3)20(12-15)29-4/h6-9,12-13,25H,5,10-11,14H2,1-4H3/q+1 |
| InChIKey | ANMQFEYBCJIBQX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_imine_ium(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|