C21H24FN2O4S+ — CID 4217595
1-(2,5-dimethoxyphenyl)-3-(2-fluoro-4-methoxyphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol (PubChem CID 4217595) has the molecular formula C21H24FN2O4S+ and a molecular weight of 419.50 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-(2-fluoro-4-methoxyphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-(2-fluoro-4-methoxyphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol |
|---|---|
| PubChem CID | 4217595 |
| Molecular Formula | C21H24FN2O4S+ |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-(2-fluoro-4-methoxyphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol |
| SMILES | COc1ccc(C2(O)CN(c3cc(OC)ccc3OC)C3=[N+]2CCCS3)c(F)c1 |
| InChI | InChI=1S/C21H24FN2O4S/c1-26-14-5-7-16(17(22)11-14)21(25)13-23(20-24(21)9-4-10-29-20)18-12-15(27-2)6-8-19(18)28-3/h5-8,11-12,25H,4,9-10,13H2,1-3H3/q+1 |
| InChIKey | SNXZWCPMJJQPDJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_imine_ium(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|