C12H15NO2 — CID 42177125
3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propanoate (PubChem CID 42177125) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propanoate.
| Compound Name | 3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propanoate |
|---|---|
| PubChem CID | 42177125 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propanoate |
| SMILES | O=C([O-])CC[NH+]1CCc2ccccc2C1 |
| InChI | InChI=1S/C12H15NO2/c14-12(15)6-8-13-7-5-10-3-1-2-4-11(10)9-13/h1-4H,5-9H2,(H,14,15) |
| InChIKey | ITBODVOTGPHBBW-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |