About S-(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl) 2,2,2-trifluoroethanethioate
S-(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl) 2,2,2-trifluoroethanethioate (PubChem CID 4217767) has the molecular formula C7H5F3N2OS2
and a molecular weight of 254.26 g/mol. Its IUPAC name is S-(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl) 2,2,2-trifluoroethanethioate.
Molecular Properties
| Compound Name | S-(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl) 2,2,2-trifluoroethanethioate |
| PubChem CID | 4217767 |
| Molecular Formula | C7H5F3N2OS2 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | S-(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl) 2,2,2-trifluoroethanethioate |
| SMILES | Cc1cc(SC(=O)C(F)(F)F)nc(=S)[nH]1 |
| InChI | InChI=1S/C7H5F3N2OS2/c1-3-2-4(12-6(14)11-3)15-5(13)7(8,9)10/h2H,1H3,(H,11,12,14) |
| InChIKey | GKNPRWAPOSDKPA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl) 2,2,2-trifluoroethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl) 2,2,2-trifluoroethanethioate?
The IUPAC name of S-(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl) 2,2,2-trifluoroethanethioate (CID 4217767) is S-(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl) 2,2,2-trifluoroethanethioate.
What is the SMILES notation for S-(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl) 2,2,2-trifluoroethanethioate?
The canonical SMILES for S-(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl) 2,2,2-trifluoroethanethioate is Cc1cc(SC(=O)C(F)(F)F)nc(=S)[nH]1.
What is the InChIKey of S-(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl) 2,2,2-trifluoroethanethioate?
The InChIKey is GKNPRWAPOSDKPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3N2OS2/c1-3-2-4(12-6(14)11-3)15-5(13)7(8,9)10/h2H,1H3,(H,11,12,14).
What are the key properties of S-(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl) 2,2,2-trifluoroethanethioate?
S-(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl) 2,2,2-trifluoroethanethioate has a molecular weight of 254.26 g/mol, XLogP of 2.63, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl) 2,2,2-trifluoroethanethioate is sourced from PubChem (CID 4217767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).