About 1,5-dimethyl-1,5-naphthyridine-2,6-dione
1,5-dimethyl-1,5-naphthyridine-2,6-dione (PubChem CID 4218362) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is 1,5-dimethyl-1,5-naphthyridine-2,6-dione.
Molecular Properties
| Compound Name | 1,5-dimethyl-1,5-naphthyridine-2,6-dione |
| PubChem CID | 4218362 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 1,5-dimethyl-1,5-naphthyridine-2,6-dione |
| SMILES | Cn1c(=O)ccc2c1ccc(=O)n2C |
| InChI | InChI=1S/C10H10N2O2/c1-11-7-3-6-10(14)12(2)8(7)4-5-9(11)13/h3-6H,1-2H3 |
| InChIKey | HJGFQDYJNIJTSE-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,5-dimethyl-1,5-naphthyridine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-1,5-naphthyridine-2,6-dione?
The IUPAC name of 1,5-dimethyl-1,5-naphthyridine-2,6-dione (CID 4218362) is 1,5-dimethyl-1,5-naphthyridine-2,6-dione.
What is the SMILES notation for 1,5-dimethyl-1,5-naphthyridine-2,6-dione?
The canonical SMILES for 1,5-dimethyl-1,5-naphthyridine-2,6-dione is Cn1c(=O)ccc2c1ccc(=O)n2C.
What is the InChIKey of 1,5-dimethyl-1,5-naphthyridine-2,6-dione?
The InChIKey is HJGFQDYJNIJTSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-11-7-3-6-10(14)12(2)8(7)4-5-9(11)13/h3-6H,1-2H3.
What are the key properties of 1,5-dimethyl-1,5-naphthyridine-2,6-dione?
1,5-dimethyl-1,5-naphthyridine-2,6-dione has a molecular weight of 190.20 g/mol, XLogP of 0.24, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-1,5-naphthyridine-2,6-dione is sourced from PubChem (CID 4218362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).