About [(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-(1H-pyrazol-4-yl)methanone
[(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-(1H-pyrazol-4-yl)methanone (PubChem CID 42188970) has the molecular formula C22H23N3O2
and a molecular weight of 361.45 g/mol. Its IUPAC name is [(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-(1H-pyrazol-4-yl)methanone.
Molecular Properties
| Compound Name | [(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-(1H-pyrazol-4-yl)methanone |
| PubChem CID | 42188970 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | [(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-(1H-pyrazol-4-yl)methanone |
| SMILES | O=C(c1cn[nH]c1)N1CCO[C@@H](CC(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C22H23N3O2/c26-22(19-14-23-24-15-19)25-11-12-27-20(16-25)13-21(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-10,14-15,20-21H,11-13,16H2,(H,23,24)/t20-/m0/s1 |
| InChIKey | HKAARKFLVINFOV-FQEVSTJZSA-N |
| XLogP | 3.47 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-(1H-pyrazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-(1H-pyrazol-4-yl)methanone?
The IUPAC name of [(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-(1H-pyrazol-4-yl)methanone (CID 42188970) is [(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-(1H-pyrazol-4-yl)methanone.
What is the SMILES notation for [(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-(1H-pyrazol-4-yl)methanone?
The canonical SMILES for [(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-(1H-pyrazol-4-yl)methanone is O=C(c1cn[nH]c1)N1CCO[C@@H](CC(c2ccccc2)c2ccccc2)C1.
What is the InChIKey of [(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-(1H-pyrazol-4-yl)methanone?
The InChIKey is HKAARKFLVINFOV-FQEVSTJZSA-N. The full InChI is InChI=1S/C22H23N3O2/c26-22(19-14-23-24-15-19)25-11-12-27-20(16-25)13-21(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-10,14-15,20-21H,11-13,16H2,(H,23,24)/t20-/m0/s1.
What are the key properties of [(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-(1H-pyrazol-4-yl)methanone?
[(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-(1H-pyrazol-4-yl)methanone has a molecular weight of 361.45 g/mol, XLogP of 3.47, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-(1H-pyrazol-4-yl)methanone is sourced from PubChem (CID 42188970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).