C20H29N3O3 — CID 42190261
N-[(2S)-1-methoxybutan-2-yl]-3-[5-(4-phenylbutyl)-1,3,4-oxadiazol-2-yl]propanamide (PubChem CID 42190261) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is N-[(2S)-1-methoxybutan-2-yl]-3-[5-(4-phenylbutyl)-1,3,4-oxadiazol-2-yl]propanamide.
| Compound Name | N-[(2S)-1-methoxybutan-2-yl]-3-[5-(4-phenylbutyl)-1,3,4-oxadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 42190261 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N-[(2S)-1-methoxybutan-2-yl]-3-[5-(4-phenylbutyl)-1,3,4-oxadiazol-2-yl]propanamide |
| SMILES | CC[C@@H](COC)NC(=O)CCc1nnc(CCCCc2ccccc2)o1 |
| InChI | InChI=1S/C20H29N3O3/c1-3-17(15-25-2)21-18(24)13-14-20-23-22-19(26-20)12-8-7-11-16-9-5-4-6-10-16/h4-6,9-10,17H,3,7-8,11-15H2,1-2H3,(H,21,24)/t17-/m0/s1 |
| InChIKey | UXJWBYDAVGGZLC-KRWDZBQOSA-N |
| XLogP | 3.11 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|