C15H19ClN2O2S — CID 4219030
2-[[(2-chlorophenyl)methyl-cyclopentylcarbamothioyl]amino]acetic acid (PubChem CID 4219030) has the molecular formula C15H19ClN2O2S and a molecular weight of 326.85 g/mol. Its IUPAC name is 2-[[(2-chlorophenyl)methyl-cyclopentylcarbamothioyl]amino]acetic acid.
| Compound Name | 2-[[(2-chlorophenyl)methyl-cyclopentylcarbamothioyl]amino]acetic acid |
|---|---|
| PubChem CID | 4219030 |
| Molecular Formula | C15H19ClN2O2S |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-[[(2-chlorophenyl)methyl-cyclopentylcarbamothioyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=S)N(Cc1ccccc1Cl)C1CCCC1 |
| InChI | InChI=1S/C15H19ClN2O2S/c16-13-8-4-1-5-11(13)10-18(12-6-2-3-7-12)15(21)17-9-14(19)20/h1,4-5,8,12H,2-3,6-7,9-10H2,(H,17,21)(H,19,20) |
| InChIKey | UUGRBIYXQMIFBE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|