C16H14N2O2 — CID 4219186
4-amino-2-(2,4-dimethylphenyl)isoindole-1,3-dione (PubChem CID 4219186) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-amino-2-(2,4-dimethylphenyl)isoindole-1,3-dione.
| Compound Name | 4-amino-2-(2,4-dimethylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 4219186 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 4-amino-2-(2,4-dimethylphenyl)isoindole-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)c3cccc(N)c3C2=O)c(C)c1 |
| InChI | InChI=1S/C16H14N2O2/c1-9-6-7-13(10(2)8-9)18-15(19)11-4-3-5-12(17)14(11)16(18)20/h3-8H,17H2,1-2H3 |
| InChIKey | LMUPCLNQKZCVMI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|