C23H18N2O3 — CID 4219274
5-(2-nitrophenyl)-2,3,5,6-tetrahydro-1H-benzo[a]phenanthridin-4-one (PubChem CID 4219274) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 5-(2-nitrophenyl)-2,3,5,6-tetrahydro-1H-benzo[a]phenanthridin-4-one.
| Compound Name | 5-(2-nitrophenyl)-2,3,5,6-tetrahydro-1H-benzo[a]phenanthridin-4-one |
|---|---|
| PubChem CID | 4219274 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 5-(2-nitrophenyl)-2,3,5,6-tetrahydro-1H-benzo[a]phenanthridin-4-one |
| SMILES | O=C1CCCC2=C1C(c1ccccc1[N+](=O)[O-])Nc1ccc3ccccc3c12 |
| InChI | InChI=1S/C23H18N2O3/c26-20-11-5-9-17-21-15-7-2-1-6-14(15)12-13-18(21)24-23(22(17)20)16-8-3-4-10-19(16)25(27)28/h1-4,6-8,10,12-13,23-24H,5,9,11H2 |
| InChIKey | LAUNDXXEUVCXFE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|