C22H24N4 — CID 42192976
(5R)-N-(3-phenylpropyl)-2-pyridin-3-yl-5,6,7,8-tetrahydroquinazolin-5-amine (PubChem CID 42192976) has the molecular formula C22H24N4 and a molecular weight of 344.46 g/mol. Its IUPAC name is (5R)-N-(3-phenylpropyl)-2-pyridin-3-yl-5,6,7,8-tetrahydroquinazolin-5-amine.
| Compound Name | (5R)-N-(3-phenylpropyl)-2-pyridin-3-yl-5,6,7,8-tetrahydroquinazolin-5-amine |
|---|---|
| PubChem CID | 42192976 |
| Molecular Formula | C22H24N4 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (5R)-N-(3-phenylpropyl)-2-pyridin-3-yl-5,6,7,8-tetrahydroquinazolin-5-amine |
| SMILES | c1ccc(CCCN[C@@H]2CCCc3nc(-c4cccnc4)ncc32)cc1 |
| InChI | InChI=1S/C22H24N4/c1-2-7-17(8-3-1)9-5-14-24-20-11-4-12-21-19(20)16-25-22(26-21)18-10-6-13-23-15-18/h1-3,6-8,10,13,15-16,20,24H,4-5,9,11-12,14H2/t20-/m1/s1 |
| InChIKey | ZITKNBWJDNKWPD-HXUWFJFHSA-N |
| XLogP | 4.14 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|