C18H24ClNOS — CID 4219378
3-[(3-chlorophenyl)methylsulfanyl]-N-[2-(cyclohexen-1-yl)ethyl]propanamide (PubChem CID 4219378) has the molecular formula C18H24ClNOS and a molecular weight of 337.92 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methylsulfanyl]-N-[2-(cyclohexen-1-yl)ethyl]propanamide.
| Compound Name | 3-[(3-chlorophenyl)methylsulfanyl]-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 4219378 |
| Molecular Formula | C18H24ClNOS |
| Molecular Weight | 337.92 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 3-[(3-chlorophenyl)methylsulfanyl]-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
| SMILES | O=C(CCSCc1cccc(Cl)c1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C18H24ClNOS/c19-17-8-4-7-16(13-17)14-22-12-10-18(21)20-11-9-15-5-2-1-3-6-15/h4-5,7-8,13H,1-3,6,9-12,14H2,(H,20,21) |
| InChIKey | LGMQZBITAKAYTJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.92 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|