C21H24N4O3 — CID 42193857
ethyl 2-[[(1R)-1-(5-methyl-1-naphthalen-1-ylpyrazol-4-yl)ethyl]carbamoylamino]acetate (PubChem CID 42193857) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is ethyl 2-[[(1R)-1-(5-methyl-1-naphthalen-1-ylpyrazol-4-yl)ethyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[(1R)-1-(5-methyl-1-naphthalen-1-ylpyrazol-4-yl)ethyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 42193857 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | ethyl 2-[[(1R)-1-(5-methyl-1-naphthalen-1-ylpyrazol-4-yl)ethyl]carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)N[C@H](C)c1cnn(-c2cccc3ccccc23)c1C |
| InChI | InChI=1S/C21H24N4O3/c1-4-28-20(26)13-22-21(27)24-14(2)18-12-23-25(15(18)3)19-11-7-9-16-8-5-6-10-17(16)19/h5-12,14H,4,13H2,1-3H3,(H2,22,24,27)/t14-/m1/s1 |
| InChIKey | XTVQJEWSZZBCIL-CQSZACIVSA-N |
| XLogP | 3.26 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |