C19H18N4O3 — CID 42194211
5-[(3-acetylphenoxy)methyl]-N-(pyridin-3-ylmethyl)-1H-pyrazole-3-carboxamide (PubChem CID 42194211) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 5-[(3-acetylphenoxy)methyl]-N-(pyridin-3-ylmethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | 5-[(3-acetylphenoxy)methyl]-N-(pyridin-3-ylmethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 42194211 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 5-[(3-acetylphenoxy)methyl]-N-(pyridin-3-ylmethyl)-1H-pyrazole-3-carboxamide |
| SMILES | CC(=O)c1cccc(OCc2cc(C(=O)NCc3cccnc3)n[nH]2)c1 |
| InChI | InChI=1S/C19H18N4O3/c1-13(24)15-5-2-6-17(8-15)26-12-16-9-18(23-22-16)19(25)21-11-14-4-3-7-20-10-14/h2-10H,11-12H2,1H3,(H,21,25)(H,22,23) |
| InChIKey | XRKXJVVTHOAJEA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |