C16H8ClIN2O4 — CID 4219568
2-(2-chloro-5-nitrophenyl)-4-[(2-iodophenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 4219568) has the molecular formula C16H8ClIN2O4 and a molecular weight of 454.61 g/mol. Its IUPAC name is 2-(2-chloro-5-nitrophenyl)-4-[(2-iodophenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-(2-chloro-5-nitrophenyl)-4-[(2-iodophenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 4219568 |
| Molecular Formula | C16H8ClIN2O4 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 453.92 |
| IUPAC Name | 2-(2-chloro-5-nitrophenyl)-4-[(2-iodophenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cc([N+](=O)[O-])ccc2Cl)=NC1=Cc1ccccc1I |
| InChI | InChI=1S/C16H8ClIN2O4/c17-12-6-5-10(20(22)23)8-11(12)15-19-14(16(21)24-15)7-9-3-1-2-4-13(9)18/h1-8H |
| InChIKey | GCPWMMPELDHFHA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|