C24H39N3O2 — CID 42195820
N-[2-(dimethylamino)ethyl]-N-methyl-3-[1-[(2S)-5-methylhex-5-en-2-yl]piperidin-4-yl]oxybenzamide (PubChem CID 42195820) has the molecular formula C24H39N3O2 and a molecular weight of 401.60 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-methyl-3-[1-[(2S)-5-methylhex-5-en-2-yl]piperidin-4-yl]oxybenzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-methyl-3-[1-[(2S)-5-methylhex-5-en-2-yl]piperidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 42195820 |
| Molecular Formula | C24H39N3O2 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.30 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-methyl-3-[1-[(2S)-5-methylhex-5-en-2-yl]piperidin-4-yl]oxybenzamide |
| SMILES | C=C(C)CC[C@H](C)N1CCC(Oc2cccc(C(=O)N(C)CCN(C)C)c2)CC1 |
| InChI | InChI=1S/C24H39N3O2/c1-19(2)10-11-20(3)27-14-12-22(13-15-27)29-23-9-7-8-21(18-23)24(28)26(6)17-16-25(4)5/h7-9,18,20,22H,1,10-17H2,2-6H3/t20-/m0/s1 |
| InChIKey | HQKCQGKTVLTNOO-FQEVSTJZSA-N |
| XLogP | 3.91 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|