About 2-(1,3-benzodioxol-5-yl)-3-(4-phenoxyphenyl)-1,3-thiazolidin-4-one
2-(1,3-benzodioxol-5-yl)-3-(4-phenoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 4220195) has the molecular formula C22H17NO4S
and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-3-(4-phenoxyphenyl)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-5-yl)-3-(4-phenoxyphenyl)-1,3-thiazolidin-4-one |
| PubChem CID | 4220195 |
| Molecular Formula | C22H17NO4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-3-(4-phenoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccc3c(c2)OCO3)N1c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H17NO4S/c24-21-13-28-22(15-6-11-19-20(12-15)26-14-25-19)23(21)16-7-9-18(10-8-16)27-17-4-2-1-3-5-17/h1-12,22H,13-14H2 |
| InChIKey | QGLMBDIIICMWNK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,3-benzodioxol-5-yl)-3-(4-phenoxyphenyl)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-5-yl)-3-(4-phenoxyphenyl)-1,3-thiazolidin-4-one?
The IUPAC name of 2-(1,3-benzodioxol-5-yl)-3-(4-phenoxyphenyl)-1,3-thiazolidin-4-one (CID 4220195) is 2-(1,3-benzodioxol-5-yl)-3-(4-phenoxyphenyl)-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-(1,3-benzodioxol-5-yl)-3-(4-phenoxyphenyl)-1,3-thiazolidin-4-one?
The canonical SMILES for 2-(1,3-benzodioxol-5-yl)-3-(4-phenoxyphenyl)-1,3-thiazolidin-4-one is O=C1CSC(c2ccc3c(c2)OCO3)N1c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 2-(1,3-benzodioxol-5-yl)-3-(4-phenoxyphenyl)-1,3-thiazolidin-4-one?
The InChIKey is QGLMBDIIICMWNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17NO4S/c24-21-13-28-22(15-6-11-19-20(12-15)26-14-25-19)23(21)16-7-9-18(10-8-16)27-17-4-2-1-3-5-17/h1-12,22H,13-14H2.
What are the key properties of 2-(1,3-benzodioxol-5-yl)-3-(4-phenoxyphenyl)-1,3-thiazolidin-4-one?
2-(1,3-benzodioxol-5-yl)-3-(4-phenoxyphenyl)-1,3-thiazolidin-4-one has a molecular weight of 391.45 g/mol, XLogP of 4.99, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-yl)-3-(4-phenoxyphenyl)-1,3-thiazolidin-4-one is sourced from PubChem (CID 4220195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).