C20H19N3O7S2 — CID 4220996
2-[5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 4220996) has the molecular formula C20H19N3O7S2 and a molecular weight of 477.52 g/mol. Its IUPAC name is 2-[5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 4220996 |
| Molecular Formula | C20H19N3O7S2 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 2-[5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | COc1ccc(C=C2SC(=O)N(CC(=O)Nc3ccc(S(N)(=O)=O)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C20H19N3O7S2/c1-29-15-8-3-12(9-16(15)30-2)10-17-19(25)23(20(26)31-17)11-18(24)22-13-4-6-14(7-5-13)32(21,27)28/h3-10H,11H2,1-2H3,(H,22,24)(H2,21,27,28) |
| InChIKey | RPIGHXHEELWVGC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|