C23H27N5OS — CID 42212158
[1-(naphthalen-1-ylmethyl)triazol-4-yl]-(4-thiomorpholin-4-ylpiperidin-1-yl)methanone (PubChem CID 42212158) has the molecular formula C23H27N5OS and a molecular weight of 421.57 g/mol. Its IUPAC name is [1-(naphthalen-1-ylmethyl)triazol-4-yl]-(4-thiomorpholin-4-ylpiperidin-1-yl)methanone.
| Compound Name | [1-(naphthalen-1-ylmethyl)triazol-4-yl]-(4-thiomorpholin-4-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 42212158 |
| Molecular Formula | C23H27N5OS |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | [1-(naphthalen-1-ylmethyl)triazol-4-yl]-(4-thiomorpholin-4-ylpiperidin-1-yl)methanone |
| SMILES | O=C(c1cn(Cc2cccc3ccccc23)nn1)N1CCC(N2CCSCC2)CC1 |
| InChI | InChI=1S/C23H27N5OS/c29-23(27-10-8-20(9-11-27)26-12-14-30-15-13-26)22-17-28(25-24-22)16-19-6-3-5-18-4-1-2-7-21(18)19/h1-7,17,20H,8-16H2 |
| InChIKey | OOCGXDXJPYASKO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |